C6H6O4 — CID 89001782
(5S,6S)-5,6-dihydroxycyclohex-2-ene-1,4-dione (PubChem CID 89001782) has the molecular formula C6H6O4 and a molecular weight of 142.11 g/mol. Its IUPAC name is (5S,6S)-5,6-dihydroxycyclohex-2-ene-1,4-dione.
| Compound Name | (5S,6S)-5,6-dihydroxycyclohex-2-ene-1,4-dione |
|---|---|
| PubChem CID | 89001782 |
| Molecular Formula | C6H6O4 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | (5S,6S)-5,6-dihydroxycyclohex-2-ene-1,4-dione |
| SMILES | O=C1C=CC(=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H6O4/c7-3-1-2-4(8)6(10)5(3)9/h1-2,5-6,9-10H/t5-,6-/m1/s1 |
| InChIKey | KGAUAKJVBKFEJK-PHDIDXHHSA-N |
| XLogP | -1.58 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |