About 2,5-dimethyl-3-[(1Z)-2-methylbuta-1,3-dienyl]oxolane
2,5-dimethyl-3-[(1Z)-2-methylbuta-1,3-dienyl]oxolane (PubChem CID 89002063) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is 2,5-dimethyl-3-[(1Z)-2-methylbuta-1,3-dienyl]oxolane.
Molecular Properties
| Compound Name | 2,5-dimethyl-3-[(1Z)-2-methylbuta-1,3-dienyl]oxolane |
| PubChem CID | 89002063 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 2,5-dimethyl-3-[(1Z)-2-methylbuta-1,3-dienyl]oxolane |
| SMILES | C=C/C(C)=C\C1CC(C)OC1C |
| InChI | InChI=1S/C11H18O/c1-5-8(2)6-11-7-9(3)12-10(11)4/h5-6,9-11H,1,7H2,2-4H3/b8-6- |
| InChIKey | OPMNIGZDQLIQCG-VURMDHGXSA-N |
| XLogP | 2.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethyl-3-[(1Z)-2-methylbuta-1,3-dienyl]oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-3-[(1Z)-2-methylbuta-1,3-dienyl]oxolane?
The IUPAC name of 2,5-dimethyl-3-[(1Z)-2-methylbuta-1,3-dienyl]oxolane (CID 89002063) is 2,5-dimethyl-3-[(1Z)-2-methylbuta-1,3-dienyl]oxolane.
What is the SMILES notation for 2,5-dimethyl-3-[(1Z)-2-methylbuta-1,3-dienyl]oxolane?
The canonical SMILES for 2,5-dimethyl-3-[(1Z)-2-methylbuta-1,3-dienyl]oxolane is C=C/C(C)=C\C1CC(C)OC1C.
What is the InChIKey of 2,5-dimethyl-3-[(1Z)-2-methylbuta-1,3-dienyl]oxolane?
The InChIKey is OPMNIGZDQLIQCG-VURMDHGXSA-N. The full InChI is InChI=1S/C11H18O/c1-5-8(2)6-11-7-9(3)12-10(11)4/h5-6,9-11H,1,7H2,2-4H3/b8-6-.
What are the key properties of 2,5-dimethyl-3-[(1Z)-2-methylbuta-1,3-dienyl]oxolane?
2,5-dimethyl-3-[(1Z)-2-methylbuta-1,3-dienyl]oxolane has a molecular weight of 166.26 g/mol, XLogP of 2.93, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-3-[(1Z)-2-methylbuta-1,3-dienyl]oxolane is sourced from PubChem (CID 89002063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).