C31H28FN7O2 — CID 89002103
[4-[[4-[6-[(2E,4Z)-6-fluorohepta-2,4,6-trien-3-yl]imidazo[2,1-b][1,3]oxazol-5-yl]pyrimidin-2-yl]amino]piperidin-1-yl]-quinolin-8-ylmethanone (PubChem CID 89002103) has the molecular formula C31H28FN7O2 and a molecular weight of 549.61 g/mol. Its IUPAC name is [4-[[4-[6-[(2E,4Z)-6-fluorohepta-2,4,6-trien-3-yl]imidazo[2,1-b][1,3]oxazol-5-yl]pyrimidin-2-yl]amino]piperidin-1-yl]-quinolin-8-ylmethanone.
| Compound Name | [4-[[4-[6-[(2E,4Z)-6-fluorohepta-2,4,6-trien-3-yl]imidazo[2,1-b][1,3]oxazol-5-yl]pyrimidin-2-yl]amino]piperidin-1-yl]-quinolin-8-ylmethanone |
|---|---|
| PubChem CID | 89002103 |
| Molecular Formula | C31H28FN7O2 |
| Molecular Weight | 549.61 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | [4-[[4-[6-[(2E,4Z)-6-fluorohepta-2,4,6-trien-3-yl]imidazo[2,1-b][1,3]oxazol-5-yl]pyrimidin-2-yl]amino]piperidin-1-yl]-quinolin-8-ylmethanone |
| SMILES | C=C(F)/C=C\C(=C/C)c1nc2occn2c1-c1ccnc(NC2CCN(C(=O)c3cccc4cccnc34)CC2)n1 |
| InChI | InChI=1S/C31H28FN7O2/c1-3-21(10-9-20(2)32)27-28(39-18-19-41-31(39)37-27)25-11-15-34-30(36-25)35-23-12-16-38(17-13-23)29(40)24-8-4-6-22-7-5-14-33-26(22)24/h3-11,14-15,18-19,23H,2,12-13,16-17H2,1H3,(H,34,35,36)/b10-9-,21-3+ |
| InChIKey | WMPKXQZJEKNTDR-AXAPJAPQSA-N |
| XLogP | 6.09 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.61 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|