C18H25BrFN3O3 — CID 89002600
ethyl 2-[5-bromo-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-2-fluoroacetate (PubChem CID 89002600) has the molecular formula C18H25BrFN3O3 and a molecular weight of 430.32 g/mol. Its IUPAC name is ethyl 2-[5-bromo-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-2-fluoroacetate.
| Compound Name | ethyl 2-[5-bromo-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-2-fluoroacetate |
|---|---|
| PubChem CID | 89002600 |
| Molecular Formula | C18H25BrFN3O3 |
| Molecular Weight | 430.32 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | ethyl 2-[5-bromo-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-2-fluoroacetate |
| SMILES | CCOC(=O)C(F)n1ncc(N[C@@H]2C[C@@H]3C[C@H]([C@H]2C)C3(C)C)c(Br)c1=O |
| InChI | InChI=1S/C18H25BrFN3O3/c1-5-26-17(25)15(20)23-16(24)14(19)13(8-21-23)22-12-7-10-6-11(9(12)2)18(10,3)4/h8-12,15,22H,5-7H2,1-4H3/t9-,10+,11-,12-,15?/m1/s1 |
| InChIKey | LPHOZYJUFIOGHW-XDYBTGMQSA-N |
| XLogP | 3.52 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |