About [(2Z)-3-methylpenta-2,4-dien-2-yl]hydrazine
[(2Z)-3-methylpenta-2,4-dien-2-yl]hydrazine (PubChem CID 89002606) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is [(2Z)-3-methylpenta-2,4-dien-2-yl]hydrazine.
Molecular Properties
| Compound Name | [(2Z)-3-methylpenta-2,4-dien-2-yl]hydrazine |
| PubChem CID | 89002606 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | [(2Z)-3-methylpenta-2,4-dien-2-yl]hydrazine |
| SMILES | C=C/C(C)=C(/C)NN |
| InChI | InChI=1S/C6H12N2/c1-4-5(2)6(3)8-7/h4,8H,1,7H2,2-3H3/b6-5- |
| InChIKey | NZBKSJIASLUASD-WAYWQWQTSA-N |
| XLogP | 0.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(2Z)-3-methylpenta-2,4-dien-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z)-3-methylpenta-2,4-dien-2-yl]hydrazine?
The IUPAC name of [(2Z)-3-methylpenta-2,4-dien-2-yl]hydrazine (CID 89002606) is [(2Z)-3-methylpenta-2,4-dien-2-yl]hydrazine.
What is the SMILES notation for [(2Z)-3-methylpenta-2,4-dien-2-yl]hydrazine?
The canonical SMILES for [(2Z)-3-methylpenta-2,4-dien-2-yl]hydrazine is C=C/C(C)=C(/C)NN.
What is the InChIKey of [(2Z)-3-methylpenta-2,4-dien-2-yl]hydrazine?
The InChIKey is NZBKSJIASLUASD-WAYWQWQTSA-N. The full InChI is InChI=1S/C6H12N2/c1-4-5(2)6(3)8-7/h4,8H,1,7H2,2-3H3/b6-5-.
What are the key properties of [(2Z)-3-methylpenta-2,4-dien-2-yl]hydrazine?
[(2Z)-3-methylpenta-2,4-dien-2-yl]hydrazine has a molecular weight of 112.18 g/mol, XLogP of 0.93, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-3-methylpenta-2,4-dien-2-yl]hydrazine is sourced from PubChem (CID 89002606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).