C15H18O2 — CID 89002724
2,5,9-trimethyl-7-methylidene-4a,5,6,8a-tetrahydrofuro[3,2-g]chromene (PubChem CID 89002724) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 2,5,9-trimethyl-7-methylidene-4a,5,6,8a-tetrahydrofuro[3,2-g]chromene.
| Compound Name | 2,5,9-trimethyl-7-methylidene-4a,5,6,8a-tetrahydrofuro[3,2-g]chromene |
|---|---|
| PubChem CID | 89002724 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2,5,9-trimethyl-7-methylidene-4a,5,6,8a-tetrahydrofuro[3,2-g]chromene |
| SMILES | C=C1CC(C)C2C=c3cc(C)oc3=C(C)C2O1 |
| InChI | InChI=1S/C15H18O2/c1-8-5-9(2)17-15-11(4)14-12(7-13(8)15)6-10(3)16-14/h6-8,13,15H,2,5H2,1,3-4H3 |
| InChIKey | IESROZSZUYGJGO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |