About (quinoxalin-2-ylamino) formate
(quinoxalin-2-ylamino) formate (PubChem CID 89003133) has the molecular formula C9H7N3O2
and a molecular weight of 189.17 g/mol. Its IUPAC name is (quinoxalin-2-ylamino) formate.
Molecular Properties
| Compound Name | (quinoxalin-2-ylamino) formate |
| PubChem CID | 89003133 |
| Molecular Formula | C9H7N3O2 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | (quinoxalin-2-ylamino) formate |
| SMILES | O=CONc1cnc2ccccc2n1 |
| InChI | InChI=1S/C9H7N3O2/c13-6-14-12-9-5-10-7-3-1-2-4-8(7)11-9/h1-6H,(H,11,12) |
| InChIKey | SPCSIUIPRZEEFN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (quinoxalin-2-ylamino) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (quinoxalin-2-ylamino) formate?
The IUPAC name of (quinoxalin-2-ylamino) formate (CID 89003133) is (quinoxalin-2-ylamino) formate.
What is the SMILES notation for (quinoxalin-2-ylamino) formate?
The canonical SMILES for (quinoxalin-2-ylamino) formate is O=CONc1cnc2ccccc2n1.
What is the InChIKey of (quinoxalin-2-ylamino) formate?
The InChIKey is SPCSIUIPRZEEFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O2/c13-6-14-12-9-5-10-7-3-1-2-4-8(7)11-9/h1-6H,(H,11,12).
What are the key properties of (quinoxalin-2-ylamino) formate?
(quinoxalin-2-ylamino) formate has a molecular weight of 189.17 g/mol, XLogP of 1.13, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (quinoxalin-2-ylamino) formate is sourced from PubChem (CID 89003133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).