C8H15NS — CID 89003574
2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazole (PubChem CID 89003574) has the molecular formula C8H15NS and a molecular weight of 157.28 g/mol. Its IUPAC name is 2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazole.
| Compound Name | 2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 89003574 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazole |
| SMILES | CC1NC2CCCCC2S1 |
| InChI | InChI=1S/C8H15NS/c1-6-9-7-4-2-3-5-8(7)10-6/h6-9H,2-5H2,1H3 |
| InChIKey | AVFMELLDJQMCRF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |