About 2,7-dimethyl-2,3-dihydroquinoline
2,7-dimethyl-2,3-dihydroquinoline (PubChem CID 89003703) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is 2,7-dimethyl-2,3-dihydroquinoline.
Molecular Properties
| Compound Name | 2,7-dimethyl-2,3-dihydroquinoline |
| PubChem CID | 89003703 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 2,7-dimethyl-2,3-dihydroquinoline |
| SMILES | Cc1ccc2c(c1)=NC(C)CC=2 |
| InChI | InChI=1S/C11H13N/c1-8-3-5-10-6-4-9(2)12-11(10)7-8/h3,5-7,9H,4H2,1-2H3 |
| InChIKey | CYMGMFLMCVZPCB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,7-dimethyl-2,3-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethyl-2,3-dihydroquinoline?
The IUPAC name of 2,7-dimethyl-2,3-dihydroquinoline (CID 89003703) is 2,7-dimethyl-2,3-dihydroquinoline.
What is the SMILES notation for 2,7-dimethyl-2,3-dihydroquinoline?
The canonical SMILES for 2,7-dimethyl-2,3-dihydroquinoline is Cc1ccc2c(c1)=NC(C)CC=2.
What is the InChIKey of 2,7-dimethyl-2,3-dihydroquinoline?
The InChIKey is CYMGMFLMCVZPCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N/c1-8-3-5-10-6-4-9(2)12-11(10)7-8/h3,5-7,9H,4H2,1-2H3.
What are the key properties of 2,7-dimethyl-2,3-dihydroquinoline?
2,7-dimethyl-2,3-dihydroquinoline has a molecular weight of 159.23 g/mol, XLogP of 1.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethyl-2,3-dihydroquinoline is sourced from PubChem (CID 89003703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).