About 6-chloro-2,7-dimethyl-6,7-dihydroquinoline
6-chloro-2,7-dimethyl-6,7-dihydroquinoline (PubChem CID 89003705) has the molecular formula C11H12ClN
and a molecular weight of 193.68 g/mol. Its IUPAC name is 6-chloro-2,7-dimethyl-6,7-dihydroquinoline.
Molecular Properties
| Compound Name | 6-chloro-2,7-dimethyl-6,7-dihydroquinoline |
| PubChem CID | 89003705 |
| Molecular Formula | C11H12ClN |
| Molecular Weight | 193.68 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 6-chloro-2,7-dimethyl-6,7-dihydroquinoline |
| SMILES | Cc1ccc2c(n1)=CC(C)C(Cl)C=2 |
| InChI | InChI=1S/C11H12ClN/c1-7-5-11-9(6-10(7)12)4-3-8(2)13-11/h3-7,10H,1-2H3 |
| InChIKey | LMNYFLYFGBZHDF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.68 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2,7-dimethyl-6,7-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2,7-dimethyl-6,7-dihydroquinoline?
The IUPAC name of 6-chloro-2,7-dimethyl-6,7-dihydroquinoline (CID 89003705) is 6-chloro-2,7-dimethyl-6,7-dihydroquinoline.
What is the SMILES notation for 6-chloro-2,7-dimethyl-6,7-dihydroquinoline?
The canonical SMILES for 6-chloro-2,7-dimethyl-6,7-dihydroquinoline is Cc1ccc2c(n1)=CC(C)C(Cl)C=2.
What is the InChIKey of 6-chloro-2,7-dimethyl-6,7-dihydroquinoline?
The InChIKey is LMNYFLYFGBZHDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClN/c1-7-5-11-9(6-10(7)12)4-3-8(2)13-11/h3-7,10H,1-2H3.
What are the key properties of 6-chloro-2,7-dimethyl-6,7-dihydroquinoline?
6-chloro-2,7-dimethyl-6,7-dihydroquinoline has a molecular weight of 193.68 g/mol, XLogP of 1.21, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2,7-dimethyl-6,7-dihydroquinoline is sourced from PubChem (CID 89003705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).