About 8,11-dioxa-1,4-diazaspiro[5.6]dodecan-5-one
8,11-dioxa-1,4-diazaspiro[5.6]dodecan-5-one (PubChem CID 89003952) has the molecular formula C8H14N2O3
and a molecular weight of 186.21 g/mol. Its IUPAC name is 8,11-dioxa-1,4-diazaspiro[5.6]dodecan-5-one.
Molecular Properties
| Compound Name | 8,11-dioxa-1,4-diazaspiro[5.6]dodecan-5-one |
| PubChem CID | 89003952 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 8,11-dioxa-1,4-diazaspiro[5.6]dodecan-5-one |
| SMILES | O=C1NCCNC12COCCOC2 |
| InChI | InChI=1S/C8H14N2O3/c11-7-8(10-2-1-9-7)5-12-3-4-13-6-8/h10H,1-6H2,(H,9,11) |
| InChIKey | VIPXLOWRHVFOBM-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8,11-dioxa-1,4-diazaspiro[5.6]dodecan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,11-dioxa-1,4-diazaspiro[5.6]dodecan-5-one?
The IUPAC name of 8,11-dioxa-1,4-diazaspiro[5.6]dodecan-5-one (CID 89003952) is 8,11-dioxa-1,4-diazaspiro[5.6]dodecan-5-one.
What is the SMILES notation for 8,11-dioxa-1,4-diazaspiro[5.6]dodecan-5-one?
The canonical SMILES for 8,11-dioxa-1,4-diazaspiro[5.6]dodecan-5-one is O=C1NCCNC12COCCOC2.
What is the InChIKey of 8,11-dioxa-1,4-diazaspiro[5.6]dodecan-5-one?
The InChIKey is VIPXLOWRHVFOBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O3/c11-7-8(10-2-1-9-7)5-12-3-4-13-6-8/h10H,1-6H2,(H,9,11).
What are the key properties of 8,11-dioxa-1,4-diazaspiro[5.6]dodecan-5-one?
8,11-dioxa-1,4-diazaspiro[5.6]dodecan-5-one has a molecular weight of 186.21 g/mol, XLogP of -1.51, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8,11-dioxa-1,4-diazaspiro[5.6]dodecan-5-one is sourced from PubChem (CID 89003952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).