C10H11ClN2O — CID 89004105
2-(chloromethyl)-5-(4-methylcyclohexa-1,5-dien-1-yl)-1,3,4-oxadiazole (PubChem CID 89004105) has the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(4-methylcyclohexa-1,5-dien-1-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(chloromethyl)-5-(4-methylcyclohexa-1,5-dien-1-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 89004105 |
| Molecular Formula | C10H11ClN2O |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 2-(chloromethyl)-5-(4-methylcyclohexa-1,5-dien-1-yl)-1,3,4-oxadiazole |
| SMILES | CC1C=CC(c2nnc(CCl)o2)=CC1 |
| InChI | InChI=1S/C10H11ClN2O/c1-7-2-4-8(5-3-7)10-13-12-9(6-11)14-10/h2,4-5,7H,3,6H2,1H3 |
| InChIKey | CSNPFVZZZACBAB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|