C12H13F3N2 — CID 89004346
1-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-4-methyl-5-(trifluoromethyl)pyrazole (PubChem CID 89004346) has the molecular formula C12H13F3N2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 1-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-4-methyl-5-(trifluoromethyl)pyrazole.
| Compound Name | 1-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-4-methyl-5-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 89004346 |
| Molecular Formula | C12H13F3N2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 1-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-4-methyl-5-(trifluoromethyl)pyrazole |
| SMILES | C/C=C\C=C/C=C/n1ncc(C)c1C(F)(F)F |
| InChI | InChI=1S/C12H13F3N2/c1-3-4-5-6-7-8-17-11(12(13,14)15)10(2)9-16-17/h3-9H,1-2H3/b4-3-,6-5-,8-7+ |
| InChIKey | KOPYVWUWALVGBH-YUHUOFHPSA-N |
| XLogP | 3.81 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|