About 5-bromocyclohexa-2,4-diene-1,2-diamine
5-bromocyclohexa-2,4-diene-1,2-diamine (PubChem CID 89004510) has the molecular formula C6H9BrN2
and a molecular weight of 189.06 g/mol. Its IUPAC name is 5-bromocyclohexa-2,4-diene-1,2-diamine.
Molecular Properties
| Compound Name | 5-bromocyclohexa-2,4-diene-1,2-diamine |
| PubChem CID | 89004510 |
| Molecular Formula | C6H9BrN2 |
| Molecular Weight | 189.06 g/mol |
| Exact Mass | 187.99 |
| IUPAC Name | 5-bromocyclohexa-2,4-diene-1,2-diamine |
| SMILES | NC1=CC=C(Br)CC1N |
| InChI | InChI=1S/C6H9BrN2/c7-4-1-2-5(8)6(9)3-4/h1-2,6H,3,8-9H2 |
| InChIKey | ZKAPAOHNKSWAIH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.06 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromocyclohexa-2,4-diene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromocyclohexa-2,4-diene-1,2-diamine?
The IUPAC name of 5-bromocyclohexa-2,4-diene-1,2-diamine (CID 89004510) is 5-bromocyclohexa-2,4-diene-1,2-diamine.
What is the SMILES notation for 5-bromocyclohexa-2,4-diene-1,2-diamine?
The canonical SMILES for 5-bromocyclohexa-2,4-diene-1,2-diamine is NC1=CC=C(Br)CC1N.
What is the InChIKey of 5-bromocyclohexa-2,4-diene-1,2-diamine?
The InChIKey is ZKAPAOHNKSWAIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrN2/c7-4-1-2-5(8)6(9)3-4/h1-2,6H,3,8-9H2.
What are the key properties of 5-bromocyclohexa-2,4-diene-1,2-diamine?
5-bromocyclohexa-2,4-diene-1,2-diamine has a molecular weight of 189.06 g/mol, XLogP of 0.84, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromocyclohexa-2,4-diene-1,2-diamine is sourced from PubChem (CID 89004510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).