About 2-butan-2-yl-5-methyl-3,4-dihydropyridine
2-butan-2-yl-5-methyl-3,4-dihydropyridine (PubChem CID 89004526) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 2-butan-2-yl-5-methyl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 2-butan-2-yl-5-methyl-3,4-dihydropyridine |
| PubChem CID | 89004526 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 2-butan-2-yl-5-methyl-3,4-dihydropyridine |
| SMILES | CCC(C)C1=NC=C(C)CC1 |
| InChI | InChI=1S/C10H17N/c1-4-9(3)10-6-5-8(2)7-11-10/h7,9H,4-6H2,1-3H3 |
| InChIKey | VRIYMWAVJLHLBJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-butan-2-yl-5-methyl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-5-methyl-3,4-dihydropyridine?
The IUPAC name of 2-butan-2-yl-5-methyl-3,4-dihydropyridine (CID 89004526) is 2-butan-2-yl-5-methyl-3,4-dihydropyridine.
What is the SMILES notation for 2-butan-2-yl-5-methyl-3,4-dihydropyridine?
The canonical SMILES for 2-butan-2-yl-5-methyl-3,4-dihydropyridine is CCC(C)C1=NC=C(C)CC1.
What is the InChIKey of 2-butan-2-yl-5-methyl-3,4-dihydropyridine?
The InChIKey is VRIYMWAVJLHLBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-4-9(3)10-6-5-8(2)7-11-10/h7,9H,4-6H2,1-3H3.
What are the key properties of 2-butan-2-yl-5-methyl-3,4-dihydropyridine?
2-butan-2-yl-5-methyl-3,4-dihydropyridine has a molecular weight of 151.25 g/mol, XLogP of 3.17, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-5-methyl-3,4-dihydropyridine is sourced from PubChem (CID 89004526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).