C30H29ClFN5O3 — CID 89004650
(4-fluorophenyl) 1-[4-[2-(5-amino-3-methyl-1,5-dihydropyrazol-2-yl)ethoxy]phenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 89004650) has the molecular formula C30H29ClFN5O3 and a molecular weight of 562.05 g/mol. Its IUPAC name is (4-fluorophenyl) 1-[4-[2-(5-amino-3-methyl-1,5-dihydropyrazol-2-yl)ethoxy]phenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-fluorophenyl) 1-[4-[2-(5-amino-3-methyl-1,5-dihydropyrazol-2-yl)ethoxy]phenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 89004650 |
| Molecular Formula | C30H29ClFN5O3 |
| Molecular Weight | 562.05 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | (4-fluorophenyl) 1-[4-[2-(5-amino-3-methyl-1,5-dihydropyrazol-2-yl)ethoxy]phenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CC1=CC(N)NN1CCOc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C(=O)Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C30H29ClFN5O3/c1-18-16-27(33)35-37(18)14-15-39-22-7-2-19(3-8-22)29-28-24(25-17-20(31)4-11-26(25)34-28)12-13-36(29)30(38)40-23-9-5-21(32)6-10-23/h2-11,16-17,27,29,34-35H,12-15,33H2,1H3 |
| InChIKey | MEIHWEQINRLFJE-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 95.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.05 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|