C13H27N — CID 89004687
(8S)-2,3,3,7,7,8-hexamethylazocane (PubChem CID 89004687) has the molecular formula C13H27N and a molecular weight of 197.37 g/mol. Its IUPAC name is (8S)-2,3,3,7,7,8-hexamethylazocane.
| Compound Name | (8S)-2,3,3,7,7,8-hexamethylazocane |
|---|---|
| PubChem CID | 89004687 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | (8S)-2,3,3,7,7,8-hexamethylazocane |
| SMILES | CC1N[C@@H](C)C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C13H27N/c1-10-12(3,4)8-7-9-13(5,6)11(2)14-10/h10-11,14H,7-9H2,1-6H3/t10-,11?/m0/s1 |
| InChIKey | UEYZZSQHXZMZLB-VUWPPUDQSA-N |
| XLogP | 3.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |