About propyl carboniodidate
propyl carboniodidate (PubChem CID 89004841) has the molecular formula C4H7IO2
and a molecular weight of 214.00 g/mol. Its IUPAC name is propyl carboniodidate.
Molecular Properties
| Compound Name | propyl carboniodidate |
| PubChem CID | 89004841 |
| Molecular Formula | C4H7IO2 |
| Molecular Weight | 214.00 g/mol |
| Exact Mass | 213.95 |
| IUPAC Name | propyl carboniodidate |
| SMILES | CCCOC(=O)I |
| InChI | InChI=1S/C4H7IO2/c1-2-3-7-4(5)6/h2-3H2,1H3 |
| InChIKey | SSBQPDOGWIPSCP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.00 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze propyl carboniodidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl carboniodidate?
The IUPAC name of propyl carboniodidate (CID 89004841) is propyl carboniodidate.
What is the SMILES notation for propyl carboniodidate?
The canonical SMILES for propyl carboniodidate is CCCOC(=O)I.
What is the InChIKey of propyl carboniodidate?
The InChIKey is SSBQPDOGWIPSCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7IO2/c1-2-3-7-4(5)6/h2-3H2,1H3.
What are the key properties of propyl carboniodidate?
propyl carboniodidate has a molecular weight of 214.00 g/mol, XLogP of 1.97, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propyl carboniodidate is sourced from PubChem (CID 89004841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).