About N-[(4R,5S)-2-oxo-4-[(E)-prop-1-enyl]-1,3-dioxan-5-yl]acetamide
N-[(4R,5S)-2-oxo-4-[(E)-prop-1-enyl]-1,3-dioxan-5-yl]acetamide (PubChem CID 89005282) has the molecular formula C9H13NO4
and a molecular weight of 199.21 g/mol. Its IUPAC name is N-[(4R,5S)-2-oxo-4-[(E)-prop-1-enyl]-1,3-dioxan-5-yl]acetamide.
Molecular Properties
| Compound Name | N-[(4R,5S)-2-oxo-4-[(E)-prop-1-enyl]-1,3-dioxan-5-yl]acetamide |
| PubChem CID | 89005282 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | N-[(4R,5S)-2-oxo-4-[(E)-prop-1-enyl]-1,3-dioxan-5-yl]acetamide |
| SMILES | C/C=C/[C@H]1OC(=O)OC[C@@H]1NC(C)=O |
| InChI | InChI=1S/C9H13NO4/c1-3-4-8-7(10-6(2)11)5-13-9(12)14-8/h3-4,7-8H,5H2,1-2H3,(H,10,11)/b4-3+/t7-,8+/m0/s1 |
| InChIKey | DITWASZPWYVJNZ-XMYQNILUSA-N |
| XLogP | 0.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(4R,5S)-2-oxo-4-[(E)-prop-1-enyl]-1,3-dioxan-5-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4R,5S)-2-oxo-4-[(E)-prop-1-enyl]-1,3-dioxan-5-yl]acetamide?
The IUPAC name of N-[(4R,5S)-2-oxo-4-[(E)-prop-1-enyl]-1,3-dioxan-5-yl]acetamide (CID 89005282) is N-[(4R,5S)-2-oxo-4-[(E)-prop-1-enyl]-1,3-dioxan-5-yl]acetamide.
What is the SMILES notation for N-[(4R,5S)-2-oxo-4-[(E)-prop-1-enyl]-1,3-dioxan-5-yl]acetamide?
The canonical SMILES for N-[(4R,5S)-2-oxo-4-[(E)-prop-1-enyl]-1,3-dioxan-5-yl]acetamide is C/C=C/[C@H]1OC(=O)OC[C@@H]1NC(C)=O.
What is the InChIKey of N-[(4R,5S)-2-oxo-4-[(E)-prop-1-enyl]-1,3-dioxan-5-yl]acetamide?
The InChIKey is DITWASZPWYVJNZ-XMYQNILUSA-N. The full InChI is InChI=1S/C9H13NO4/c1-3-4-8-7(10-6(2)11)5-13-9(12)14-8/h3-4,7-8H,5H2,1-2H3,(H,10,11)/b4-3+/t7-,8+/m0/s1.
What are the key properties of N-[(4R,5S)-2-oxo-4-[(E)-prop-1-enyl]-1,3-dioxan-5-yl]acetamide?
N-[(4R,5S)-2-oxo-4-[(E)-prop-1-enyl]-1,3-dioxan-5-yl]acetamide has a molecular weight of 199.21 g/mol, XLogP of 0.60, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4R,5S)-2-oxo-4-[(E)-prop-1-enyl]-1,3-dioxan-5-yl]acetamide is sourced from PubChem (CID 89005282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).