About 7-sulfanyl-1,7a-dihydropyrrolo[2,3-b]pyridine
7-sulfanyl-1,7a-dihydropyrrolo[2,3-b]pyridine (PubChem CID 89005583) has the molecular formula C7H8N2S
and a molecular weight of 152.22 g/mol. Its IUPAC name is 7-sulfanyl-1,7a-dihydropyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 7-sulfanyl-1,7a-dihydropyrrolo[2,3-b]pyridine |
| PubChem CID | 89005583 |
| Molecular Formula | C7H8N2S |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 7-sulfanyl-1,7a-dihydropyrrolo[2,3-b]pyridine |
| SMILES | SN1C=CC=C2C=CNC21 |
| InChI | InChI=1S/C7H8N2S/c10-9-5-1-2-6-3-4-8-7(6)9/h1-5,7-8,10H |
| InChIKey | OQOVUICROWHNIU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 7-sulfanyl-1,7a-dihydropyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-sulfanyl-1,7a-dihydropyrrolo[2,3-b]pyridine?
The IUPAC name of 7-sulfanyl-1,7a-dihydropyrrolo[2,3-b]pyridine (CID 89005583) is 7-sulfanyl-1,7a-dihydropyrrolo[2,3-b]pyridine.
What is the SMILES notation for 7-sulfanyl-1,7a-dihydropyrrolo[2,3-b]pyridine?
The canonical SMILES for 7-sulfanyl-1,7a-dihydropyrrolo[2,3-b]pyridine is SN1C=CC=C2C=CNC21.
What is the InChIKey of 7-sulfanyl-1,7a-dihydropyrrolo[2,3-b]pyridine?
The InChIKey is OQOVUICROWHNIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2S/c10-9-5-1-2-6-3-4-8-7(6)9/h1-5,7-8,10H.
What are the key properties of 7-sulfanyl-1,7a-dihydropyrrolo[2,3-b]pyridine?
7-sulfanyl-1,7a-dihydropyrrolo[2,3-b]pyridine has a molecular weight of 152.22 g/mol, XLogP of 1.03, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-sulfanyl-1,7a-dihydropyrrolo[2,3-b]pyridine is sourced from PubChem (CID 89005583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).