About 1,5-dimethyl-6-methylidene-2H-1,3,5-triazine
1,5-dimethyl-6-methylidene-2H-1,3,5-triazine (PubChem CID 89005770) has the molecular formula C6H11N3
and a molecular weight of 125.17 g/mol. Its IUPAC name is 1,5-dimethyl-6-methylidene-2H-1,3,5-triazine.
Molecular Properties
| Compound Name | 1,5-dimethyl-6-methylidene-2H-1,3,5-triazine |
| PubChem CID | 89005770 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 1,5-dimethyl-6-methylidene-2H-1,3,5-triazine |
| SMILES | C=C1N(C)C=NCN1C |
| InChI | InChI=1S/C6H11N3/c1-6-8(2)4-7-5-9(6)3/h4H,1,5H2,2-3H3 |
| InChIKey | KDKPALKPYXKZSH-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,5-dimethyl-6-methylidene-2H-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-6-methylidene-2H-1,3,5-triazine?
The IUPAC name of 1,5-dimethyl-6-methylidene-2H-1,3,5-triazine (CID 89005770) is 1,5-dimethyl-6-methylidene-2H-1,3,5-triazine.
What is the SMILES notation for 1,5-dimethyl-6-methylidene-2H-1,3,5-triazine?
The canonical SMILES for 1,5-dimethyl-6-methylidene-2H-1,3,5-triazine is C=C1N(C)C=NCN1C.
What is the InChIKey of 1,5-dimethyl-6-methylidene-2H-1,3,5-triazine?
The InChIKey is KDKPALKPYXKZSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3/c1-6-8(2)4-7-5-9(6)3/h4H,1,5H2,2-3H3.
What are the key properties of 1,5-dimethyl-6-methylidene-2H-1,3,5-triazine?
1,5-dimethyl-6-methylidene-2H-1,3,5-triazine has a molecular weight of 125.17 g/mol, XLogP of 0.32, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-6-methylidene-2H-1,3,5-triazine is sourced from PubChem (CID 89005770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).