About cyclohex-3-en-1-yl-(2,2-dioxooxathian-3-yl)methanol
cyclohex-3-en-1-yl-(2,2-dioxooxathian-3-yl)methanol (PubChem CID 89006292) has the molecular formula C11H18O4S
and a molecular weight of 246.33 g/mol. Its IUPAC name is cyclohex-3-en-1-yl-(2,2-dioxooxathian-3-yl)methanol.
Molecular Properties
| Compound Name | cyclohex-3-en-1-yl-(2,2-dioxooxathian-3-yl)methanol |
| PubChem CID | 89006292 |
| Molecular Formula | C11H18O4S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | cyclohex-3-en-1-yl-(2,2-dioxooxathian-3-yl)methanol |
| SMILES | O=S1(=O)OCCCC1C(O)C1CC=CCC1 |
| InChI | InChI=1S/C11H18O4S/c12-11(9-5-2-1-3-6-9)10-7-4-8-15-16(10,13)14/h1-2,9-12H,3-8H2 |
| InChIKey | POCPCRFCJLXXQF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohex-3-en-1-yl-(2,2-dioxooxathian-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohex-3-en-1-yl-(2,2-dioxooxathian-3-yl)methanol?
The IUPAC name of cyclohex-3-en-1-yl-(2,2-dioxooxathian-3-yl)methanol (CID 89006292) is cyclohex-3-en-1-yl-(2,2-dioxooxathian-3-yl)methanol.
What is the SMILES notation for cyclohex-3-en-1-yl-(2,2-dioxooxathian-3-yl)methanol?
The canonical SMILES for cyclohex-3-en-1-yl-(2,2-dioxooxathian-3-yl)methanol is O=S1(=O)OCCCC1C(O)C1CC=CCC1.
What is the InChIKey of cyclohex-3-en-1-yl-(2,2-dioxooxathian-3-yl)methanol?
The InChIKey is POCPCRFCJLXXQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4S/c12-11(9-5-2-1-3-6-9)10-7-4-8-15-16(10,13)14/h1-2,9-12H,3-8H2.
What are the key properties of cyclohex-3-en-1-yl-(2,2-dioxooxathian-3-yl)methanol?
cyclohex-3-en-1-yl-(2,2-dioxooxathian-3-yl)methanol has a molecular weight of 246.33 g/mol, XLogP of 1.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohex-3-en-1-yl-(2,2-dioxooxathian-3-yl)methanol is sourced from PubChem (CID 89006292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).