C14H16S2 — CID 89006398
1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]sulfanyl-2-methylsulfanylbenzene (PubChem CID 89006398) has the molecular formula C14H16S2 and a molecular weight of 248.42 g/mol. Its IUPAC name is 1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]sulfanyl-2-methylsulfanylbenzene.
| Compound Name | 1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]sulfanyl-2-methylsulfanylbenzene |
|---|---|
| PubChem CID | 89006398 |
| Molecular Formula | C14H16S2 |
| Molecular Weight | 248.42 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]sulfanyl-2-methylsulfanylbenzene |
| SMILES | C=C/C=C\C=C(/C)Sc1ccccc1SC |
| InChI | InChI=1S/C14H16S2/c1-4-5-6-9-12(2)16-14-11-8-7-10-13(14)15-3/h4-11H,1H2,2-3H3/b6-5-,12-9+ |
| InChIKey | BRFXFWAJDIZRQU-ZCRLHDOISA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.42 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|