About 4-[(2,4,6-triaminopyrimidin-5-yl)diazenyl]benzaldehyde
4-[(2,4,6-triaminopyrimidin-5-yl)diazenyl]benzaldehyde (PubChem CID 89006402) has the molecular formula C11H11N7O
and a molecular weight of 257.26 g/mol. Its IUPAC name is 4-[(2,4,6-triaminopyrimidin-5-yl)diazenyl]benzaldehyde.
Molecular Properties
| Compound Name | 4-[(2,4,6-triaminopyrimidin-5-yl)diazenyl]benzaldehyde |
| PubChem CID | 89006402 |
| Molecular Formula | C11H11N7O |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 4-[(2,4,6-triaminopyrimidin-5-yl)diazenyl]benzaldehyde |
| SMILES | Nc1nc(N)c(/N=N/c2ccc(C=O)cc2)c(N)n1 |
| InChI | InChI=1S/C11H11N7O/c12-9-8(10(13)16-11(14)15-9)18-17-7-3-1-6(5-19)2-4-7/h1-5H,(H6,12,13,14,15,16)/b18-17+ |
| InChIKey | PVCFQPDWQXVXHL-ISLYRVAYSA-N |
| XLogP | 1.45 |
| TPSA | 145.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,4,6-triaminopyrimidin-5-yl)diazenyl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,4,6-triaminopyrimidin-5-yl)diazenyl]benzaldehyde?
The IUPAC name of 4-[(2,4,6-triaminopyrimidin-5-yl)diazenyl]benzaldehyde (CID 89006402) is 4-[(2,4,6-triaminopyrimidin-5-yl)diazenyl]benzaldehyde.
What is the SMILES notation for 4-[(2,4,6-triaminopyrimidin-5-yl)diazenyl]benzaldehyde?
The canonical SMILES for 4-[(2,4,6-triaminopyrimidin-5-yl)diazenyl]benzaldehyde is Nc1nc(N)c(/N=N/c2ccc(C=O)cc2)c(N)n1.
What is the InChIKey of 4-[(2,4,6-triaminopyrimidin-5-yl)diazenyl]benzaldehyde?
The InChIKey is PVCFQPDWQXVXHL-ISLYRVAYSA-N. The full InChI is InChI=1S/C11H11N7O/c12-9-8(10(13)16-11(14)15-9)18-17-7-3-1-6(5-19)2-4-7/h1-5H,(H6,12,13,14,15,16)/b18-17+.
What are the key properties of 4-[(2,4,6-triaminopyrimidin-5-yl)diazenyl]benzaldehyde?
4-[(2,4,6-triaminopyrimidin-5-yl)diazenyl]benzaldehyde has a molecular weight of 257.26 g/mol, XLogP of 1.45, 3 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4,6-triaminopyrimidin-5-yl)diazenyl]benzaldehyde is sourced from PubChem (CID 89006402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).