C33H40N4O5 — CID 89006429
(3R,4S,5S)-2-[[3-(benzamidomethyl)phenyl]methyl]-N-[3-(2,3-dihydroindol-1-yl)propyl]-4-[(1R)-1-hydroxyethyl]-5-(hydroxymethyl)-1,2-oxazolidine-3-carboxamide (PubChem CID 89006429) has the molecular formula C33H40N4O5 and a molecular weight of 572.71 g/mol. Its IUPAC name is (3R,4S,5S)-2-[[3-(benzamidomethyl)phenyl]methyl]-N-[3-(2,3-dihydroindol-1-yl)propyl]-4-[(1R)-1-hydroxyethyl]-5-(hydroxymethyl)-1,2-oxazolidine-3-carboxamide.
| Compound Name | (3R,4S,5S)-2-[[3-(benzamidomethyl)phenyl]methyl]-N-[3-(2,3-dihydroindol-1-yl)propyl]-4-[(1R)-1-hydroxyethyl]-5-(hydroxymethyl)-1,2-oxazolidine-3-carboxamide |
|---|---|
| PubChem CID | 89006429 |
| Molecular Formula | C33H40N4O5 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | (3R,4S,5S)-2-[[3-(benzamidomethyl)phenyl]methyl]-N-[3-(2,3-dihydroindol-1-yl)propyl]-4-[(1R)-1-hydroxyethyl]-5-(hydroxymethyl)-1,2-oxazolidine-3-carboxamide |
| SMILES | C[C@@H](O)[C@H]1[C@@H](CO)ON(Cc2cccc(CNC(=O)c3ccccc3)c2)[C@H]1C(=O)NCCCN1CCc2ccccc21 |
| InChI | InChI=1S/C33H40N4O5/c1-23(39)30-29(22-38)42-37(21-25-10-7-9-24(19-25)20-35-32(40)27-12-3-2-4-13-27)31(30)33(41)34-16-8-17-36-18-15-26-11-5-6-14-28(26)36/h2-7,9-14,19,23,29-31,38-39H,8,15-18,20-22H2,1H3,(H,34,41)(H,35,40)/t23-,29-,30+,31-/m1/s1 |
| InChIKey | LLYJROPTGYKBEO-HZBYMDMISA-N |
| XLogP | 2.66 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|