C17H23FN6OS — CID 89006808
N'-(4-tert-butylphenyl)-4-(4-fluoro-1,2,5-thiadiazol-3-yl)-N-hydroxypiperazine-1-carboximidamide (PubChem CID 89006808) has the molecular formula C17H23FN6OS and a molecular weight of 378.48 g/mol. Its IUPAC name is N'-(4-tert-butylphenyl)-4-(4-fluoro-1,2,5-thiadiazol-3-yl)-N-hydroxypiperazine-1-carboximidamide.
| Compound Name | N'-(4-tert-butylphenyl)-4-(4-fluoro-1,2,5-thiadiazol-3-yl)-N-hydroxypiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 89006808 |
| Molecular Formula | C17H23FN6OS |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N'-(4-tert-butylphenyl)-4-(4-fluoro-1,2,5-thiadiazol-3-yl)-N-hydroxypiperazine-1-carboximidamide |
| SMILES | CC(C)(C)c1ccc(/N=C(\NO)N2CCN(c3nsnc3F)CC2)cc1 |
| InChI | InChI=1S/C17H23FN6OS/c1-17(2,3)12-4-6-13(7-5-12)19-16(20-25)24-10-8-23(9-11-24)15-14(18)21-26-22-15/h4-7,25H,8-11H2,1-3H3,(H,19,20) |
| InChIKey | YGRXSQUXRFXJGO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|