C19H28N6OS — CID 89006865
N'-(4-tert-butylphenyl)-N-methoxy-4-(4-methyl-1,2,5-thiadiazol-3-yl)piperazine-1-carboximidamide (PubChem CID 89006865) has the molecular formula C19H28N6OS and a molecular weight of 388.54 g/mol. Its IUPAC name is N'-(4-tert-butylphenyl)-N-methoxy-4-(4-methyl-1,2,5-thiadiazol-3-yl)piperazine-1-carboximidamide.
| Compound Name | N'-(4-tert-butylphenyl)-N-methoxy-4-(4-methyl-1,2,5-thiadiazol-3-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 89006865 |
| Molecular Formula | C19H28N6OS |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | N'-(4-tert-butylphenyl)-N-methoxy-4-(4-methyl-1,2,5-thiadiazol-3-yl)piperazine-1-carboximidamide |
| SMILES | CON/C(=N\c1ccc(C(C)(C)C)cc1)N1CCN(c2nsnc2C)CC1 |
| InChI | InChI=1S/C19H28N6OS/c1-14-17(23-27-22-14)24-10-12-25(13-11-24)18(21-26-5)20-16-8-6-15(7-9-16)19(2,3)4/h6-9H,10-13H2,1-5H3,(H,20,21) |
| InChIKey | GZYHNLFBTSVIAN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|