C11H10F8O6S — CID 89007044
1,1,1,3,3,4,4,4-octafluoro-2-(2-oxocyclohexyl)oxycarbonylbutane-2-sulfonic acid (PubChem CID 89007044) has the molecular formula C11H10F8O6S and a molecular weight of 422.25 g/mol. Its IUPAC name is 1,1,1,3,3,4,4,4-octafluoro-2-(2-oxocyclohexyl)oxycarbonylbutane-2-sulfonic acid.
| Compound Name | 1,1,1,3,3,4,4,4-octafluoro-2-(2-oxocyclohexyl)oxycarbonylbutane-2-sulfonic acid |
|---|---|
| PubChem CID | 89007044 |
| Molecular Formula | C11H10F8O6S |
| Molecular Weight | 422.25 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | 1,1,1,3,3,4,4,4-octafluoro-2-(2-oxocyclohexyl)oxycarbonylbutane-2-sulfonic acid |
| SMILES | O=C1CCCCC1OC(=O)C(C(F)(F)F)(C(F)(F)C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C11H10F8O6S/c12-9(13,11(17,18)19)8(10(14,15)16,26(22,23)24)7(21)25-6-4-2-1-3-5(6)20/h6H,1-4H2,(H,22,23,24) |
| InChIKey | AKCBEPKOZBXBIC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|