About 4-tert-butyl-3,5-diethyl-1,2-dihydroimidazole
4-tert-butyl-3,5-diethyl-1,2-dihydroimidazole (PubChem CID 89007274) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is 4-tert-butyl-3,5-diethyl-1,2-dihydroimidazole.
Molecular Properties
| Compound Name | 4-tert-butyl-3,5-diethyl-1,2-dihydroimidazole |
| PubChem CID | 89007274 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 4-tert-butyl-3,5-diethyl-1,2-dihydroimidazole |
| SMILES | CCC1=C(C(C)(C)C)N(CC)CN1 |
| InChI | InChI=1S/C11H22N2/c1-6-9-10(11(3,4)5)13(7-2)8-12-9/h12H,6-8H2,1-5H3 |
| InChIKey | FKVORDVWZBJMAR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butyl-3,5-diethyl-1,2-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-3,5-diethyl-1,2-dihydroimidazole?
The IUPAC name of 4-tert-butyl-3,5-diethyl-1,2-dihydroimidazole (CID 89007274) is 4-tert-butyl-3,5-diethyl-1,2-dihydroimidazole.
What is the SMILES notation for 4-tert-butyl-3,5-diethyl-1,2-dihydroimidazole?
The canonical SMILES for 4-tert-butyl-3,5-diethyl-1,2-dihydroimidazole is CCC1=C(C(C)(C)C)N(CC)CN1.
What is the InChIKey of 4-tert-butyl-3,5-diethyl-1,2-dihydroimidazole?
The InChIKey is FKVORDVWZBJMAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2/c1-6-9-10(11(3,4)5)13(7-2)8-12-9/h12H,6-8H2,1-5H3.
What are the key properties of 4-tert-butyl-3,5-diethyl-1,2-dihydroimidazole?
4-tert-butyl-3,5-diethyl-1,2-dihydroimidazole has a molecular weight of 182.31 g/mol, XLogP of 2.54, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-3,5-diethyl-1,2-dihydroimidazole is sourced from PubChem (CID 89007274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).