About (2S)-2-tert-butyl-1-ethyl-4,4-difluoropyrrolidine
(2S)-2-tert-butyl-1-ethyl-4,4-difluoropyrrolidine (PubChem CID 89007348) has the molecular formula C10H19F2N
and a molecular weight of 191.26 g/mol. Its IUPAC name is (2S)-2-tert-butyl-1-ethyl-4,4-difluoropyrrolidine.
Molecular Properties
| Compound Name | (2S)-2-tert-butyl-1-ethyl-4,4-difluoropyrrolidine |
| PubChem CID | 89007348 |
| Molecular Formula | C10H19F2N |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.15 |
| IUPAC Name | (2S)-2-tert-butyl-1-ethyl-4,4-difluoropyrrolidine |
| SMILES | CCN1CC(F)(F)C[C@H]1C(C)(C)C |
| InChI | InChI=1S/C10H19F2N/c1-5-13-7-10(11,12)6-8(13)9(2,3)4/h8H,5-7H2,1-4H3/t8-/m0/s1 |
| InChIKey | ZLALGTWEUMMDMO-QMMMGPOBSA-N |
| XLogP | 2.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-2-tert-butyl-1-ethyl-4,4-difluoropyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-tert-butyl-1-ethyl-4,4-difluoropyrrolidine?
The IUPAC name of (2S)-2-tert-butyl-1-ethyl-4,4-difluoropyrrolidine (CID 89007348) is (2S)-2-tert-butyl-1-ethyl-4,4-difluoropyrrolidine.
What is the SMILES notation for (2S)-2-tert-butyl-1-ethyl-4,4-difluoropyrrolidine?
The canonical SMILES for (2S)-2-tert-butyl-1-ethyl-4,4-difluoropyrrolidine is CCN1CC(F)(F)C[C@H]1C(C)(C)C.
What is the InChIKey of (2S)-2-tert-butyl-1-ethyl-4,4-difluoropyrrolidine?
The InChIKey is ZLALGTWEUMMDMO-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H19F2N/c1-5-13-7-10(11,12)6-8(13)9(2,3)4/h8H,5-7H2,1-4H3/t8-/m0/s1.
What are the key properties of (2S)-2-tert-butyl-1-ethyl-4,4-difluoropyrrolidine?
(2S)-2-tert-butyl-1-ethyl-4,4-difluoropyrrolidine has a molecular weight of 191.26 g/mol, XLogP of 2.76, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-tert-butyl-1-ethyl-4,4-difluoropyrrolidine is sourced from PubChem (CID 89007348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).