About 5-ethyl-3,3-dimethyl-4-(2-methylbutan-2-yl)-2H-furan
5-ethyl-3,3-dimethyl-4-(2-methylbutan-2-yl)-2H-furan (PubChem CID 89007542) has the molecular formula C13H24O
and a molecular weight of 196.33 g/mol. Its IUPAC name is 5-ethyl-3,3-dimethyl-4-(2-methylbutan-2-yl)-2H-furan.
Molecular Properties
| Compound Name | 5-ethyl-3,3-dimethyl-4-(2-methylbutan-2-yl)-2H-furan |
| PubChem CID | 89007542 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | 5-ethyl-3,3-dimethyl-4-(2-methylbutan-2-yl)-2H-furan |
| SMILES | CCC1=C(C(C)(C)CC)C(C)(C)CO1 |
| InChI | InChI=1S/C13H24O/c1-7-10-11(12(3,4)8-2)13(5,6)9-14-10/h7-9H2,1-6H3 |
| InChIKey | FIDMVTIKKNPUQZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethyl-3,3-dimethyl-4-(2-methylbutan-2-yl)-2H-furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-3,3-dimethyl-4-(2-methylbutan-2-yl)-2H-furan?
The IUPAC name of 5-ethyl-3,3-dimethyl-4-(2-methylbutan-2-yl)-2H-furan (CID 89007542) is 5-ethyl-3,3-dimethyl-4-(2-methylbutan-2-yl)-2H-furan.
What is the SMILES notation for 5-ethyl-3,3-dimethyl-4-(2-methylbutan-2-yl)-2H-furan?
The canonical SMILES for 5-ethyl-3,3-dimethyl-4-(2-methylbutan-2-yl)-2H-furan is CCC1=C(C(C)(C)CC)C(C)(C)CO1.
What is the InChIKey of 5-ethyl-3,3-dimethyl-4-(2-methylbutan-2-yl)-2H-furan?
The InChIKey is FIDMVTIKKNPUQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O/c1-7-10-11(12(3,4)8-2)13(5,6)9-14-10/h7-9H2,1-6H3.
What are the key properties of 5-ethyl-3,3-dimethyl-4-(2-methylbutan-2-yl)-2H-furan?
5-ethyl-3,3-dimethyl-4-(2-methylbutan-2-yl)-2H-furan has a molecular weight of 196.33 g/mol, XLogP of 4.14, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-3,3-dimethyl-4-(2-methylbutan-2-yl)-2H-furan is sourced from PubChem (CID 89007542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).