About (1Z)-3-methyl-1-(2,2,3-trimethylcyclopent-3-en-1-ylidene)butan-1-ol
(1Z)-3-methyl-1-(2,2,3-trimethylcyclopent-3-en-1-ylidene)butan-1-ol (PubChem CID 89007600) has the molecular formula C13H22O
and a molecular weight of 194.32 g/mol. Its IUPAC name is (1Z)-3-methyl-1-(2,2,3-trimethylcyclopent-3-en-1-ylidene)butan-1-ol.
Molecular Properties
| Compound Name | (1Z)-3-methyl-1-(2,2,3-trimethylcyclopent-3-en-1-ylidene)butan-1-ol |
| PubChem CID | 89007600 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | (1Z)-3-methyl-1-(2,2,3-trimethylcyclopent-3-en-1-ylidene)butan-1-ol |
| SMILES | CC1=CC/C(=C(/O)CC(C)C)C1(C)C |
| InChI | InChI=1S/C13H22O/c1-9(2)8-12(14)11-7-6-10(3)13(11,4)5/h6,9,14H,7-8H2,1-5H3/b12-11- |
| InChIKey | TUBOYXNIRDACHV-QXMHVHEDSA-N |
| XLogP | 4.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-3-methyl-1-(2,2,3-trimethylcyclopent-3-en-1-ylidene)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-3-methyl-1-(2,2,3-trimethylcyclopent-3-en-1-ylidene)butan-1-ol?
The IUPAC name of (1Z)-3-methyl-1-(2,2,3-trimethylcyclopent-3-en-1-ylidene)butan-1-ol (CID 89007600) is (1Z)-3-methyl-1-(2,2,3-trimethylcyclopent-3-en-1-ylidene)butan-1-ol.
What is the SMILES notation for (1Z)-3-methyl-1-(2,2,3-trimethylcyclopent-3-en-1-ylidene)butan-1-ol?
The canonical SMILES for (1Z)-3-methyl-1-(2,2,3-trimethylcyclopent-3-en-1-ylidene)butan-1-ol is CC1=CC/C(=C(/O)CC(C)C)C1(C)C.
What is the InChIKey of (1Z)-3-methyl-1-(2,2,3-trimethylcyclopent-3-en-1-ylidene)butan-1-ol?
The InChIKey is TUBOYXNIRDACHV-QXMHVHEDSA-N. The full InChI is InChI=1S/C13H22O/c1-9(2)8-12(14)11-7-6-10(3)13(11,4)5/h6,9,14H,7-8H2,1-5H3/b12-11-.
What are the key properties of (1Z)-3-methyl-1-(2,2,3-trimethylcyclopent-3-en-1-ylidene)butan-1-ol?
(1Z)-3-methyl-1-(2,2,3-trimethylcyclopent-3-en-1-ylidene)butan-1-ol has a molecular weight of 194.32 g/mol, XLogP of 4.22, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-3-methyl-1-(2,2,3-trimethylcyclopent-3-en-1-ylidene)butan-1-ol is sourced from PubChem (CID 89007600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).