C30H38O5S — CID 89007663
[(8R,9R,11S,12S,13R)-11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.11,5.05,14]pentadecanyl] 2-(2-formylphenyl)sulfanylacetate (PubChem CID 89007663) has the molecular formula C30H38O5S and a molecular weight of 510.70 g/mol. Its IUPAC name is [(8R,9R,11S,12S,13R)-11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.11,5.05,14]pentadecanyl] 2-(2-formylphenyl)sulfanylacetate.
| Compound Name | [(8R,9R,11S,12S,13R)-11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.11,5.05,14]pentadecanyl] 2-(2-formylphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 89007663 |
| Molecular Formula | C30H38O5S |
| Molecular Weight | 510.70 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | [(8R,9R,11S,12S,13R)-11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.11,5.05,14]pentadecanyl] 2-(2-formylphenyl)sulfanylacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CSc2ccccc2C=O)C2(C)C(C)CC34CC(CCC3=O)(C42)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C30H38O5S/c1-6-27(4)14-23(35-24(33)16-36-21-10-8-7-9-20(21)15-31)28(5)18(2)13-30-17-29(26(28)30,12-11-22(30)32)19(3)25(27)34/h6-10,15,18-19,23,25-26,34H,1,11-14,16-17H2,2-5H3/t18?,19-,23+,25-,26?,27+,28?,29?,30?/m0/s1 |
| InChIKey | BUAGJZTVBIRELG-HPJHZSRNSA-N |
| XLogP | 5.50 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.70 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|