About ethyl 2-cyano-2-[(4Z)-1,3-dimethyl-4-(2-methylpropylidene)cyclopentyl]pent-4-enoate
ethyl 2-cyano-2-[(4Z)-1,3-dimethyl-4-(2-methylpropylidene)cyclopentyl]pent-4-enoate (PubChem CID 89007803) has the molecular formula C19H29NO2
and a molecular weight of 303.45 g/mol. Its IUPAC name is ethyl 2-cyano-2-[(4Z)-1,3-dimethyl-4-(2-methylpropylidene)cyclopentyl]pent-4-enoate.
Molecular Properties
| Compound Name | ethyl 2-cyano-2-[(4Z)-1,3-dimethyl-4-(2-methylpropylidene)cyclopentyl]pent-4-enoate |
| PubChem CID | 89007803 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | ethyl 2-cyano-2-[(4Z)-1,3-dimethyl-4-(2-methylpropylidene)cyclopentyl]pent-4-enoate |
| SMILES | C=CCC(C#N)(C(=O)OCC)C1(C)C/C(=C/C(C)C)C(C)C1 |
| InChI | InChI=1S/C19H29NO2/c1-7-9-19(13-20,17(21)22-8-2)18(6)11-15(5)16(12-18)10-14(3)4/h7,10,14-15H,1,8-9,11-12H2,2-6H3/b16-10- |
| InChIKey | HTJZLCWDZVNNKQ-YBEGLDIGSA-N |
| XLogP | 4.65 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-cyano-2-[(4Z)-1,3-dimethyl-4-(2-methylpropylidene)cyclopentyl]pent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-cyano-2-[(4Z)-1,3-dimethyl-4-(2-methylpropylidene)cyclopentyl]pent-4-enoate?
The IUPAC name of ethyl 2-cyano-2-[(4Z)-1,3-dimethyl-4-(2-methylpropylidene)cyclopentyl]pent-4-enoate (CID 89007803) is ethyl 2-cyano-2-[(4Z)-1,3-dimethyl-4-(2-methylpropylidene)cyclopentyl]pent-4-enoate.
What is the SMILES notation for ethyl 2-cyano-2-[(4Z)-1,3-dimethyl-4-(2-methylpropylidene)cyclopentyl]pent-4-enoate?
The canonical SMILES for ethyl 2-cyano-2-[(4Z)-1,3-dimethyl-4-(2-methylpropylidene)cyclopentyl]pent-4-enoate is C=CCC(C#N)(C(=O)OCC)C1(C)C/C(=C/C(C)C)C(C)C1.
What is the InChIKey of ethyl 2-cyano-2-[(4Z)-1,3-dimethyl-4-(2-methylpropylidene)cyclopentyl]pent-4-enoate?
The InChIKey is HTJZLCWDZVNNKQ-YBEGLDIGSA-N. The full InChI is InChI=1S/C19H29NO2/c1-7-9-19(13-20,17(21)22-8-2)18(6)11-15(5)16(12-18)10-14(3)4/h7,10,14-15H,1,8-9,11-12H2,2-6H3/b16-10-.
What are the key properties of ethyl 2-cyano-2-[(4Z)-1,3-dimethyl-4-(2-methylpropylidene)cyclopentyl]pent-4-enoate?
ethyl 2-cyano-2-[(4Z)-1,3-dimethyl-4-(2-methylpropylidene)cyclopentyl]pent-4-enoate has a molecular weight of 303.45 g/mol, XLogP of 4.65, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-cyano-2-[(4Z)-1,3-dimethyl-4-(2-methylpropylidene)cyclopentyl]pent-4-enoate is sourced from PubChem (CID 89007803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).