C17H13F6N5O — CID 89007907
4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-2-[(2,4,5-trifluorophenyl)methyl]butanenitrile (PubChem CID 89007907) has the molecular formula C17H13F6N5O and a molecular weight of 417.31 g/mol. Its IUPAC name is 4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-2-[(2,4,5-trifluorophenyl)methyl]butanenitrile.
| Compound Name | 4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-2-[(2,4,5-trifluorophenyl)methyl]butanenitrile |
|---|---|
| PubChem CID | 89007907 |
| Molecular Formula | C17H13F6N5O |
| Molecular Weight | 417.31 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-2-[(2,4,5-trifluorophenyl)methyl]butanenitrile |
| SMILES | N#CC(CC(=O)N1CCn2c(nnc2C(F)(F)F)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C17H13F6N5O/c18-11-6-13(20)12(19)5-10(11)3-9(7-24)4-15(29)27-1-2-28-14(8-27)25-26-16(28)17(21,22)23/h5-6,9H,1-4,8H2 |
| InChIKey | CWOGQVUGEBLCRI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 74.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|