About N'-[(1Z)-buta-1,3-dienyl]propanimidamide
N'-[(1Z)-buta-1,3-dienyl]propanimidamide (PubChem CID 89008112) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is N'-[(1Z)-buta-1,3-dienyl]propanimidamide.
Molecular Properties
| Compound Name | N'-[(1Z)-buta-1,3-dienyl]propanimidamide |
| PubChem CID | 89008112 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | N'-[(1Z)-buta-1,3-dienyl]propanimidamide |
| SMILES | C=C/C=C\N=C(\N)CC |
| InChI | InChI=1S/C7H12N2/c1-3-5-6-9-7(8)4-2/h3,5-6H,1,4H2,2H3,(H2,8,9)/b6-5- |
| InChIKey | GRWFWNSWMQBSCO-WAYWQWQTSA-N |
| XLogP | 1.45 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(1Z)-buta-1,3-dienyl]propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(1Z)-buta-1,3-dienyl]propanimidamide?
The IUPAC name of N'-[(1Z)-buta-1,3-dienyl]propanimidamide (CID 89008112) is N'-[(1Z)-buta-1,3-dienyl]propanimidamide.
What is the SMILES notation for N'-[(1Z)-buta-1,3-dienyl]propanimidamide?
The canonical SMILES for N'-[(1Z)-buta-1,3-dienyl]propanimidamide is C=C/C=C\N=C(\N)CC.
What is the InChIKey of N'-[(1Z)-buta-1,3-dienyl]propanimidamide?
The InChIKey is GRWFWNSWMQBSCO-WAYWQWQTSA-N. The full InChI is InChI=1S/C7H12N2/c1-3-5-6-9-7(8)4-2/h3,5-6H,1,4H2,2H3,(H2,8,9)/b6-5-.
What are the key properties of N'-[(1Z)-buta-1,3-dienyl]propanimidamide?
N'-[(1Z)-buta-1,3-dienyl]propanimidamide has a molecular weight of 124.19 g/mol, XLogP of 1.45, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(1Z)-buta-1,3-dienyl]propanimidamide is sourced from PubChem (CID 89008112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).