About 4-fluoro-2-(hydroxymethyl)-2,3-dihydrofuran-3-ol
4-fluoro-2-(hydroxymethyl)-2,3-dihydrofuran-3-ol (PubChem CID 89008544) has the molecular formula C5H7FO3
and a molecular weight of 134.11 g/mol. Its IUPAC name is 4-fluoro-2-(hydroxymethyl)-2,3-dihydrofuran-3-ol.
Molecular Properties
| Compound Name | 4-fluoro-2-(hydroxymethyl)-2,3-dihydrofuran-3-ol |
| PubChem CID | 89008544 |
| Molecular Formula | C5H7FO3 |
| Molecular Weight | 134.11 g/mol |
| Exact Mass | 134.04 |
| IUPAC Name | 4-fluoro-2-(hydroxymethyl)-2,3-dihydrofuran-3-ol |
| SMILES | OCC1OC=C(F)C1O |
| InChI | InChI=1S/C5H7FO3/c6-3-2-9-4(1-7)5(3)8/h2,4-5,7-8H,1H2 |
| InChIKey | DKXMASGJDYETSC-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.11 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-fluoro-2-(hydroxymethyl)-2,3-dihydrofuran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2-(hydroxymethyl)-2,3-dihydrofuran-3-ol?
The IUPAC name of 4-fluoro-2-(hydroxymethyl)-2,3-dihydrofuran-3-ol (CID 89008544) is 4-fluoro-2-(hydroxymethyl)-2,3-dihydrofuran-3-ol.
What is the SMILES notation for 4-fluoro-2-(hydroxymethyl)-2,3-dihydrofuran-3-ol?
The canonical SMILES for 4-fluoro-2-(hydroxymethyl)-2,3-dihydrofuran-3-ol is OCC1OC=C(F)C1O.
What is the InChIKey of 4-fluoro-2-(hydroxymethyl)-2,3-dihydrofuran-3-ol?
The InChIKey is DKXMASGJDYETSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7FO3/c6-3-2-9-4(1-7)5(3)8/h2,4-5,7-8H,1H2.
What are the key properties of 4-fluoro-2-(hydroxymethyl)-2,3-dihydrofuran-3-ol?
4-fluoro-2-(hydroxymethyl)-2,3-dihydrofuran-3-ol has a molecular weight of 134.11 g/mol, XLogP of -0.45, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2-(hydroxymethyl)-2,3-dihydrofuran-3-ol is sourced from PubChem (CID 89008544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).