About methyl (2R)-3-(1,3-dioxetan-2-yl)-2-hydroxypropanoate
methyl (2R)-3-(1,3-dioxetan-2-yl)-2-hydroxypropanoate (PubChem CID 89008625) has the molecular formula C6H10O5
and a molecular weight of 162.14 g/mol. Its IUPAC name is methyl (2R)-3-(1,3-dioxetan-2-yl)-2-hydroxypropanoate.
Molecular Properties
| Compound Name | methyl (2R)-3-(1,3-dioxetan-2-yl)-2-hydroxypropanoate |
| PubChem CID | 89008625 |
| Molecular Formula | C6H10O5 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | methyl (2R)-3-(1,3-dioxetan-2-yl)-2-hydroxypropanoate |
| SMILES | COC(=O)[C@H](O)CC1OCO1 |
| InChI | InChI=1S/C6H10O5/c1-9-6(8)4(7)2-5-10-3-11-5/h4-5,7H,2-3H2,1H3/t4-/m1/s1 |
| InChIKey | GYYXPPUDKYGTLS-SCSAIBSYSA-N |
| XLogP | -0.76 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (2R)-3-(1,3-dioxetan-2-yl)-2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-3-(1,3-dioxetan-2-yl)-2-hydroxypropanoate?
The IUPAC name of methyl (2R)-3-(1,3-dioxetan-2-yl)-2-hydroxypropanoate (CID 89008625) is methyl (2R)-3-(1,3-dioxetan-2-yl)-2-hydroxypropanoate.
What is the SMILES notation for methyl (2R)-3-(1,3-dioxetan-2-yl)-2-hydroxypropanoate?
The canonical SMILES for methyl (2R)-3-(1,3-dioxetan-2-yl)-2-hydroxypropanoate is COC(=O)[C@H](O)CC1OCO1.
What is the InChIKey of methyl (2R)-3-(1,3-dioxetan-2-yl)-2-hydroxypropanoate?
The InChIKey is GYYXPPUDKYGTLS-SCSAIBSYSA-N. The full InChI is InChI=1S/C6H10O5/c1-9-6(8)4(7)2-5-10-3-11-5/h4-5,7H,2-3H2,1H3/t4-/m1/s1.
What are the key properties of methyl (2R)-3-(1,3-dioxetan-2-yl)-2-hydroxypropanoate?
methyl (2R)-3-(1,3-dioxetan-2-yl)-2-hydroxypropanoate has a molecular weight of 162.14 g/mol, XLogP of -0.76, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-3-(1,3-dioxetan-2-yl)-2-hydroxypropanoate is sourced from PubChem (CID 89008625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).