About 4-(3-methylbutan-2-yl)-1,2-dihydropyridine
4-(3-methylbutan-2-yl)-1,2-dihydropyridine (PubChem CID 89008856) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 4-(3-methylbutan-2-yl)-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 4-(3-methylbutan-2-yl)-1,2-dihydropyridine |
| PubChem CID | 89008856 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 4-(3-methylbutan-2-yl)-1,2-dihydropyridine |
| SMILES | CC(C)C(C)C1=CCNC=C1 |
| InChI | InChI=1S/C10H17N/c1-8(2)9(3)10-4-6-11-7-5-10/h4-6,8-9,11H,7H2,1-3H3 |
| InChIKey | OEGYISOERUBUMQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(3-methylbutan-2-yl)-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methylbutan-2-yl)-1,2-dihydropyridine?
The IUPAC name of 4-(3-methylbutan-2-yl)-1,2-dihydropyridine (CID 89008856) is 4-(3-methylbutan-2-yl)-1,2-dihydropyridine.
What is the SMILES notation for 4-(3-methylbutan-2-yl)-1,2-dihydropyridine?
The canonical SMILES for 4-(3-methylbutan-2-yl)-1,2-dihydropyridine is CC(C)C(C)C1=CCNC=C1.
What is the InChIKey of 4-(3-methylbutan-2-yl)-1,2-dihydropyridine?
The InChIKey is OEGYISOERUBUMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-8(2)9(3)10-4-6-11-7-5-10/h4-6,8-9,11H,7H2,1-3H3.
What are the key properties of 4-(3-methylbutan-2-yl)-1,2-dihydropyridine?
4-(3-methylbutan-2-yl)-1,2-dihydropyridine has a molecular weight of 151.25 g/mol, XLogP of 2.32, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methylbutan-2-yl)-1,2-dihydropyridine is sourced from PubChem (CID 89008856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).