C13H23N — CID 89009127
2,4,5,6-tetramethyl-3-azatricyclo[5.2.1.02,6]decane (PubChem CID 89009127) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 2,4,5,6-tetramethyl-3-azatricyclo[5.2.1.02,6]decane.
| Compound Name | 2,4,5,6-tetramethyl-3-azatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 89009127 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 2,4,5,6-tetramethyl-3-azatricyclo[5.2.1.02,6]decane |
| SMILES | CC1NC2(C)C3CCC(C3)C2(C)C1C |
| InChI | InChI=1S/C13H23N/c1-8-9(2)14-13(4)11-6-5-10(7-11)12(8,13)3/h8-11,14H,5-7H2,1-4H3 |
| InChIKey | IUUISDMKVOERNU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |