C18H24FN3O5 — CID 89009448
6-[[(1S,4R,9R,12R,13R)-1,9-dimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]amino]-5-fluoro-1H-pyrimidin-2-one (PubChem CID 89009448) has the molecular formula C18H24FN3O5 and a molecular weight of 381.40 g/mol. Its IUPAC name is 6-[[(1S,4R,9R,12R,13R)-1,9-dimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]amino]-5-fluoro-1H-pyrimidin-2-one.
| Compound Name | 6-[[(1S,4R,9R,12R,13R)-1,9-dimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]amino]-5-fluoro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 89009448 |
| Molecular Formula | C18H24FN3O5 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 6-[[(1S,4R,9R,12R,13R)-1,9-dimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]amino]-5-fluoro-1H-pyrimidin-2-one |
| SMILES | C[C@H]1C(Nc2[nH]c(=O)ncc2F)O[C@@H]2O[C@]3(C)CC[C@H]4CCCC1[C@]42OO3 |
| InChI | InChI=1S/C18H24FN3O5/c1-9-11-5-3-4-10-6-7-17(2)25-15(18(10,11)27-26-17)24-14(9)21-13-12(19)8-20-16(23)22-13/h8-11,14-15H,3-7H2,1-2H3,(H2,20,21,22,23)/t9-,10-,11?,14?,15-,17+,18-/m1/s1 |
| InChIKey | BGSYKSPEKZBEKA-KBGGEDMSSA-N |
| XLogP | 2.28 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|