C11H16F2 — CID 89009580
(2Z,4Z)-7,7-difluoro-4-methyl-6-methylidenenona-2,4-diene (PubChem CID 89009580) has the molecular formula C11H16F2 and a molecular weight of 186.24 g/mol. Its IUPAC name is (2Z,4Z)-7,7-difluoro-4-methyl-6-methylidenenona-2,4-diene.
| Compound Name | (2Z,4Z)-7,7-difluoro-4-methyl-6-methylidenenona-2,4-diene |
|---|---|
| PubChem CID | 89009580 |
| Molecular Formula | C11H16F2 |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | (2Z,4Z)-7,7-difluoro-4-methyl-6-methylidenenona-2,4-diene |
| SMILES | C=C(/C=C(C)\C=C/C)C(F)(F)CC |
| InChI | InChI=1S/C11H16F2/c1-5-7-9(3)8-10(4)11(12,13)6-2/h5,7-8H,4,6H2,1-3H3/b7-5-,9-8- |
| InChIKey | MAJWVRREHVEQRF-PJHABFGRSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|