About 1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-amine
1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-amine (PubChem CID 89009612) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-amine.
Molecular Properties
| Compound Name | 1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-amine |
| PubChem CID | 89009612 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-amine |
| SMILES | CC1c2cccn2CCN1N |
| InChI | InChI=1S/C8H13N3/c1-7-8-3-2-4-10(8)5-6-11(7)9/h2-4,7H,5-6,9H2,1H3 |
| InChIKey | SBBPFQOOZNKVHV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 34.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-amine?
The IUPAC name of 1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-amine (CID 89009612) is 1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-amine.
What is the SMILES notation for 1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-amine?
The canonical SMILES for 1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-amine is CC1c2cccn2CCN1N.
What is the InChIKey of 1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-amine?
The InChIKey is SBBPFQOOZNKVHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-7-8-3-2-4-10(8)5-6-11(7)9/h2-4,7H,5-6,9H2,1H3.
What are the key properties of 1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-amine?
1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-amine has a molecular weight of 151.21 g/mol, XLogP of 0.74, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-amine is sourced from PubChem (CID 89009612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).