C15H15ClFN3O3S — CID 89009638
N-[6-chloro-4-(5-fluoro-2,3,6,7-tetrahydroindole-1-carbonyl)-2-pyridinyl]methanesulfonamide (PubChem CID 89009638) has the molecular formula C15H15ClFN3O3S and a molecular weight of 371.82 g/mol. Its IUPAC name is N-[6-chloro-4-(5-fluoro-2,3,6,7-tetrahydroindole-1-carbonyl)-2-pyridinyl]methanesulfonamide.
| Compound Name | N-[6-chloro-4-(5-fluoro-2,3,6,7-tetrahydroindole-1-carbonyl)-2-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 89009638 |
| Molecular Formula | C15H15ClFN3O3S |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | N-[6-chloro-4-(5-fluoro-2,3,6,7-tetrahydroindole-1-carbonyl)-2-pyridinyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(C(=O)N2CCC3=C2CCC(F)=C3)cc(Cl)n1 |
| InChI | InChI=1S/C15H15ClFN3O3S/c1-24(22,23)19-14-8-10(7-13(16)18-14)15(21)20-5-4-9-6-11(17)2-3-12(9)20/h6-8H,2-5H2,1H3,(H,18,19) |
| InChIKey | LSNRHAXAXLVLQU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|