C24H22BN7O2 — CID 89009696
CID 89009696 (PubChem CID 89009696) has the molecular formula C24H22BN7O2 and a molecular weight of 451.30 g/mol.
| Compound Name | CID 89009696 |
|---|---|
| PubChem CID | 89009696 |
| Molecular Formula | C24H22BN7O2 |
| Molecular Weight | 451.30 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)CCN2C(=O)c1cc(N2CCC(n3c(=O)[nH]c4ncccc43)CC2)ncn1 |
| InChI | InChI=1S/C24H22BN7O2/c25-16-3-4-19-15(12-16)5-11-31(19)23(33)18-13-21(28-14-27-18)30-9-6-17(7-10-30)32-20-2-1-8-26-22(20)29-24(32)34/h1-4,8,12-14,17H,5-7,9-11H2,(H,26,29,34) |
| InChIKey | VDNJWLNNDPZSLX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|