About CID 89009739
CID 89009739 (PubChem CID 89009739) has the molecular formula C18H32BO11P
and a molecular weight of 466.23 g/mol.
Molecular Properties
| Compound Name | CID 89009739 |
| PubChem CID | 89009739 |
| Molecular Formula | C18H32BO11P |
| Molecular Weight | 466.23 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | — |
| SMILES | [B]C1O[C@H](COP(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C18H32BO11P/c1-16(2,3)14(21)25-9-28-31(24,29-10-26-15(22)17(4,5)6)27-8-11-12(20)18(7,23)13(19)30-11/h11-13,20,23H,8-10H2,1-7H3/t11-,12-,13?,18-/m1/s1 |
| InChIKey | LJUUVDKYGUALLA-ZLRZHCHESA-N |
| XLogP | 1.24 |
| TPSA | 147.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 89009739 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89009739?
The IUPAC name of CID 89009739 (CID 89009739) is not available.
What is the SMILES notation for CID 89009739?
The canonical SMILES for CID 89009739 is [B]C1O[C@H](COP(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C)[C@@H](O)[C@@]1(C)O.
What is the InChIKey of CID 89009739?
The InChIKey is LJUUVDKYGUALLA-ZLRZHCHESA-N. The full InChI is InChI=1S/C18H32BO11P/c1-16(2,3)14(21)25-9-28-31(24,29-10-26-15(22)17(4,5)6)27-8-11-12(20)18(7,23)13(19)30-11/h11-13,20,23H,8-10H2,1-7H3/t11-,12-,13?,18-/m1/s1.
What are the key properties of CID 89009739?
CID 89009739 has a molecular weight of 466.23 g/mol, XLogP of 1.24, 9 rotatable bonds, 2 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89009739 is sourced from PubChem (CID 89009739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).