C9H16N2 — CID 89009886
(4,5,5-trimethyl-2,6-dihydro-1H-pyridin-3-yl)methanimine (PubChem CID 89009886) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (4,5,5-trimethyl-2,6-dihydro-1H-pyridin-3-yl)methanimine.
| Compound Name | (4,5,5-trimethyl-2,6-dihydro-1H-pyridin-3-yl)methanimine |
|---|---|
| PubChem CID | 89009886 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (4,5,5-trimethyl-2,6-dihydro-1H-pyridin-3-yl)methanimine |
| SMILES | [H]/N=C/C1=C(C)C(C)(C)CNC1 |
| InChI | InChI=1S/C9H16N2/c1-7-8(4-10)5-11-6-9(7,2)3/h4,10-11H,5-6H2,1-3H3/b10-4+ |
| InChIKey | PVXCUHKKMPVZJM-ONNFQVAWSA-N |
| XLogP | 1.58 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|