C15H16N12 — CID 89009909
1-pyrimidin-2-yl-5-[[2,4,6-tris(methylamino)pyrimidin-5-yl]diazenyl]pyrazole-4-carbonitrile (PubChem CID 89009909) has the molecular formula C15H16N12 and a molecular weight of 364.38 g/mol. Its IUPAC name is 1-pyrimidin-2-yl-5-[[2,4,6-tris(methylamino)pyrimidin-5-yl]diazenyl]pyrazole-4-carbonitrile.
| Compound Name | 1-pyrimidin-2-yl-5-[[2,4,6-tris(methylamino)pyrimidin-5-yl]diazenyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 89009909 |
| Molecular Formula | C15H16N12 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 1-pyrimidin-2-yl-5-[[2,4,6-tris(methylamino)pyrimidin-5-yl]diazenyl]pyrazole-4-carbonitrile |
| SMILES | CNc1nc(NC)c(/N=N/c2c(C#N)cnn2-c2ncccn2)c(NC)n1 |
| InChI | InChI=1S/C15H16N12/c1-17-11-10(12(18-2)24-14(19-3)23-11)25-26-13-9(7-16)8-22-27(13)15-20-5-4-6-21-15/h4-6,8H,1-3H3,(H3,17,18,19,23,24)/b26-25+ |
| InChIKey | INBGDZIWLVLWIV-OCEACIFDSA-N |
| XLogP | 1.86 |
| TPSA | 153.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|