C14H22N2 — CID 89010002
(2Z,4E,5Z,7Z)-5-ethyl-4-prop-2-enylidenenona-2,5,7-triene-1,6-diamine (PubChem CID 89010002) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is (2Z,4E,5Z,7Z)-5-ethyl-4-prop-2-enylidenenona-2,5,7-triene-1,6-diamine.
| Compound Name | (2Z,4E,5Z,7Z)-5-ethyl-4-prop-2-enylidenenona-2,5,7-triene-1,6-diamine |
|---|---|
| PubChem CID | 89010002 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | (2Z,4E,5Z,7Z)-5-ethyl-4-prop-2-enylidenenona-2,5,7-triene-1,6-diamine |
| SMILES | C=C/C=C(\C=C/CN)C(/CC)=C(N)/C=C\C |
| InChI | InChI=1S/C14H22N2/c1-4-8-12(10-7-11-15)13(6-3)14(16)9-5-2/h4-5,7-10H,1,6,11,15-16H2,2-3H3/b9-5-,10-7-,12-8+,14-13- |
| InChIKey | GKQGDWTXWBHCNS-WZWHZMTQSA-N |
| XLogP | 2.81 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|