C7H13N3O — CID 89010016
(1E,3E)-1-methoxyhexa-1,3,5-triene-1,3,5-triamine (PubChem CID 89010016) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is (1E,3E)-1-methoxyhexa-1,3,5-triene-1,3,5-triamine.
| Compound Name | (1E,3E)-1-methoxyhexa-1,3,5-triene-1,3,5-triamine |
|---|---|
| PubChem CID | 89010016 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | (1E,3E)-1-methoxyhexa-1,3,5-triene-1,3,5-triamine |
| SMILES | C=C(N)/C=C(N)\C=C(/N)OC |
| InChI | InChI=1S/C7H13N3O/c1-5(8)3-6(9)4-7(10)11-2/h3-4H,1,8-10H2,2H3/b6-3+,7-4+ |
| InChIKey | IZQWOUGTXDNNFB-XOKGJFMYSA-N |
| XLogP | -0.25 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|